CAS 2230800-18-5 appears in our catalog under these names: 1-(Hydroxymethyl)-3,3-dimethyl-2-oxabicyclo(2.1.1)hexane-4-carboxylic acid, 98%, 1-(Hydroxymethyl)-3,3-dimethyl-2-oxabicyclo(2.1.1)hexane-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
1-(hydroxymethyl)-3,3-dimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid (CAS 2230800-18-5) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: 1-(hydroxymethyl)-3,3-dimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid. InChIKey: QNCUCVHLJKLDKN-UHFFFAOYSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 1-(hydroxymethyl)-3,3-dimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid |
| InChIKey | QNCUCVHLJKLDKN-UHFFFAOYSA-N |
| SMILES | CC1(C2(CC(C2)(O1)CO)C(=O)O)C |
Computed by PubChem (NCBI)