CAS 2230800-88-9 is the registry number for Eltrombopag Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(3-amino-2-hydroxyphenyl)benzoate (CAS 2230800-88-9) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: methyl 3-(3-amino-2-hydroxyphenyl)benzoate. InChIKey: PXHJBOLPJKYNHH-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | methyl 3-(3-amino-2-hydroxyphenyl)benzoate |
| InChIKey | PXHJBOLPJKYNHH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=C(C(=CC=C2)N)O |
Computed by PubChem (NCBI)