CAS 2230803-71-9 is the registry number for Methyl 4-(1-(aminomethyl)cyclopropyl)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 4-[1-(aminomethyl)cyclopropyl]benzoate;hydrochloride (CAS 2230803-71-9) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: methyl 4-[1-(aminomethyl)cyclopropyl]benzoate;hydrochloride. InChIKey: HFKVOOBHFZTEST-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | methyl 4-[1-(aminomethyl)cyclopropyl]benzoate;hydrochloride |
| InChIKey | HFKVOOBHFZTEST-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2(CC2)CN.Cl |
Computed by PubChem (NCBI)