CAS 2230807-43-7 is the registry number for 5-Oxa-11-azadispiro(3.1.3{6}.3{4})dodecane hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-oxa-11-azadispiro[3.1.36.34]dodecane;hydrochloride (CAS 2230807-43-7) is a chemical compound with the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. IUPAC name: 5-oxa-11-azadispiro[3.1.36.34]dodecane;hydrochloride. InChIKey: JSRZIBHJLNETHN-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | 5-oxa-11-azadispiro[3.1.36.34]dodecane;hydrochloride |
| InChIKey | JSRZIBHJLNETHN-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CNCC3(O2)CCC3.Cl |
Computed by PubChem (NCBI)