Products 2230840-18-1
CAS 2230840-18-1 is the registry number for 6-Bromo-4-chloro-7-methoxy-2-methylquinazoline, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-4-chloro-7-methoxy-2-methylquinazoline (CAS 2230840-18-1) is a chemical compound with the molecular formula C10H8BrClN2O and a molecular weight of 287.54 g/mol. IUPAC name: 6-bromo-4-chloro-7-methoxy-2-methylquinazoline. InChIKey: IUMTYOIHFSMPLQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClN2O |
|---|---|
| Molecular weight | 287.54 g/mol |
| IUPAC name | 6-bromo-4-chloro-7-methoxy-2-methylquinazoline |
| InChIKey | IUMTYOIHFSMPLQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2C(=N1)Cl)Br)OC |
Computed by PubChem (NCBI)