Products 2230901-01-4
CAS 2230901-01-4 appears in our catalog under these names: (2R,5R)-1-((tert-Butoxy)carbonyl)-5-phenylpyrrolidine-2-carboxylic acid, (2R,5R)-1-(TERT-BUTOXYCARBONYL)-5-PHENYLPYRROLIDINE-2-CARBOXYLIC ACID, 95%, 95%, (2R,5R)-Boc-5-Ph-Pro-OH, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg, 25mg, 1g.
(2R,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpyrrolidine-2-carboxylic acid (CAS 2230901-01-4) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: (2R,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpyrrolidine-2-carboxylic acid. InChIKey: ADTXMICUZGOWDF-CHWSQXEVSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (2R,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | ADTXMICUZGOWDF-CHWSQXEVSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CC[C@@H]1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)