Products 2230913-73-0
CAS 2230913-73-0 is the registry number for 5-Bromo-2,2-dimethylindoline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
5-bromo-2,2-dimethyl-1,3-dihydroindole;hydrochloride (CAS 2230913-73-0) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 5-bromo-2,2-dimethyl-1,3-dihydroindole;hydrochloride. InChIKey: OECRVHPZCSVQFD-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 5-bromo-2,2-dimethyl-1,3-dihydroindole;hydrochloride |
| InChIKey | OECRVHPZCSVQFD-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(N1)C=CC(=C2)Br)C.Cl |
Computed by PubChem (NCBI)