Products 22316-24-1
CAS 22316-24-1 appears in our catalog under these names: Clobazam Impurity 2（Clobazam EP Impurity B）, Clobazam EP Impurity B, Deschloro Clobazam, >95% (HPLC), Deschloroclobazam. Offered by: Hubei YoungXin, Chemat Brand, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 5mg.
1-methyl-5-phenyl-1,5-benzodiazepine-2,4-dione (CAS 22316-24-1) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 1-methyl-5-phenyl-1,5-benzodiazepine-2,4-dione. InChIKey: NZZYMDHMGHIKLN-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 1-methyl-5-phenyl-1,5-benzodiazepine-2,4-dione |
| InChIKey | NZZYMDHMGHIKLN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(=O)N(C2=CC=CC=C21)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
1-Methyl-5-phenyl-1H-1,5-benzodiazepine-2,4(3H,5H)-dione, Deschloroclobazam, 1H-1,5-Benzodiazepine-2,4(3H,5H)-dione, 1-methyl-5-phenyl-, Deschloro Clobazam, 1-methyl-5-phenyl-1,5-benzodiazepine-2,4-dione, Clobazam EP Impurity B, Clobazam impurity B, 1-Methyl-5-phenyl-1H-1,5-benzodiazepine-2,4(3H,5H)-dione; Clobazam Imp. B (EP), Deschloro Clobozam, Clobazam EP Impurity B