CAS 22316-50-3 is the registry number for N-Desmethyl Dechloro Clobazam. Offered by: TRC. Available pack sizes: 250mg.
5-phenyl-1H-1,5-benzodiazepine-2,4-dione (CAS 22316-50-3) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 5-phenyl-1H-1,5-benzodiazepine-2,4-dione. InChIKey: CBRLXMKQJJHXPL-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 5-phenyl-1H-1,5-benzodiazepine-2,4-dione |
| InChIKey | CBRLXMKQJJHXPL-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC=CC=C2N(C1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)