CAS 2231665-11-3 is the registry number for (1S,3R)-3-(Trifluoromethyl)cyclohexan-1-amine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Cis-(1S,3R)-3-(trifluoromethyl)cyclohexan-1-amine;hydrochloride (CAS 2231665-11-3) is a chemical compound with the molecular formula C7H13ClF3N and a molecular weight of 203.63 g/mol. IUPAC name: cis-(1S,3R)-3-(trifluoromethyl)cyclohexan-1-amine;hydrochloride. InChIKey: RCSIEAABDZVSPX-IBTYICNHSA-N.
| Molecular formula | C7H13ClF3N |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | cis-(1S,3R)-3-(trifluoromethyl)cyclohexan-1-amine;hydrochloride |
| InChIKey | RCSIEAABDZVSPX-IBTYICNHSA-N |
| SMILES | C1C[C@H](C[C@H](C1)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)