Products 2231676-56-3

CAS 2231676-56-3 is the registry number for 6-bromo-1,3-dimethyl-1H-pyrrolo[3,2-b]pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

6-bromo-1,3-dimethylpyrrolo[3,2-b]pyridine (CAS 2231676-56-3) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-1,3-dimethylpyrrolo[3,2-b]pyridine. InChIKey: WYZFFKZNMKAVLF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrN2
Molecular weight225.08 g/mol
IUPAC name6-bromo-1,3-dimethylpyrrolo[3,2-b]pyridine
InChIKeyWYZFFKZNMKAVLF-UHFFFAOYSA-N
SMILESCC1=CN(C2=C1N=CC(=C2)Br)C

Computed by PubChem (NCBI)