CAS 2231676-56-3 is the registry number for 6-bromo-1,3-dimethyl-1H-pyrrolo[3,2-b]pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-bromo-1,3-dimethylpyrrolo[3,2-b]pyridine (CAS 2231676-56-3) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-1,3-dimethylpyrrolo[3,2-b]pyridine. InChIKey: WYZFFKZNMKAVLF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-1,3-dimethylpyrrolo[3,2-b]pyridine |
| InChIKey | WYZFFKZNMKAVLF-UHFFFAOYSA-N |
| SMILES | CC1=CN(C2=C1N=CC(=C2)Br)C |
Computed by PubChem (NCBI)