CAS 2232201-72-6 appears in our catalog under these names: Brivaracetam Impurity 38, Brivaracetam Impurity 58. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 200mg, 10mg, 25mg, 50mg, 100mg.
(2S)-2-(2-hydroxy-5-oxo-3-propyl-2H-pyrrol-1-yl)butanamide (CAS 2232201-72-6) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: (2S)-2-(2-hydroxy-5-oxo-3-propyl-2H-pyrrol-1-yl)butanamide. InChIKey: USYHDFNYBODPOL-YMNIQAILSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (2S)-2-(2-hydroxy-5-oxo-3-propyl-2H-pyrrol-1-yl)butanamide |
| InChIKey | USYHDFNYBODPOL-YMNIQAILSA-N |
| SMILES | CCCC1=CC(=O)N(C1O)[C@@H](CC)C(=O)N |
Computed by PubChem (NCBI)