CAS 22323-67-7 is the registry number for Methyl 2,3,4-tri-O-methyl-β-D-galactopyranoside. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 500mg, 250mg.
[(2R,3S,4S,5R,6R)-3,4,5,6-tetramethoxyoxan-2-yl]methanol (CAS 22323-67-7) is a chemical compound with the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5,6-tetramethoxyoxan-2-yl]methanol. InChIKey: JHDALIZZECJEBZ-SOYHJAILSA-N.
| Molecular formula | C10H20O6 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetramethoxyoxan-2-yl]methanol |
| InChIKey | JHDALIZZECJEBZ-SOYHJAILSA-N |
| SMILES | CO[C@H]1[C@H](O[C@H]([C@@H]([C@H]1OC)OC)OC)CO |
Computed by PubChem (NCBI)