CAS 7506-68-5 appears in our catalog under these names: 2,3,4,6-Tetramethyl-d-glucose, 95%, (3R,4S,5R,6R)–3,4,5–trimethoxy–6–(methoxymethyl)tetrahydro–2H–pyran–2–ol, 2,3,4,6-Tetra-O-methyl-D-glucose, 2,3,4,6-Tetramethyl-D-glucose. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2000mg, 1000mg.
(3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-ol (CAS 7506-68-5) is a chemical compound with the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. IUPAC name: (3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-ol. InChIKey: AQWPITGEZPPXTJ-ZKZCYXTQSA-N.
| Molecular formula | C10H20O6 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-ol |
| InChIKey | AQWPITGEZPPXTJ-ZKZCYXTQSA-N |
| SMILES | COC[C@@H]1[C@H]([C@@H]([C@H](C(O1)O)OC)OC)OC |
Computed by PubChem (NCBI)