CAS 29074-04-2 appears in our catalog under these names: T-Butyl d-glucoside, 95%, tert-Butyl β-D-glucopyranoside. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 250mg, 100mg, Get quote.
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxy]oxane-3,4,5-triol (CAS 29074-04-2) is a chemical compound with the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxy]oxane-3,4,5-triol. InChIKey: FYTBMEIHHNSHKR-LOFWALOHSA-N.
| Molecular formula | C10H20O6 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[(2-methylpropan-2-yl)oxy]oxane-3,4,5-triol |
| InChIKey | FYTBMEIHHNSHKR-LOFWALOHSA-N |
| SMILES | CC(C)(C)OC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)