CAS 80971-60-4 appears in our catalog under these names: n–Butyl–β–D–fructofuranoside, n-Butyl-β-D-fructofuranoside, n-Butyl-β-D-fructofuranoside, 97.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 1 mg, 5 mg.
(2R,3S,4S,5R)-2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol (CAS 80971-60-4) is a chemical compound with the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. IUPAC name: (2R,3S,4S,5R)-2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol. InChIKey: XRGRZXPJJVQDJO-DOLQZWNJSA-N.
| Molecular formula | C10H20O6 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-butoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | XRGRZXPJJVQDJO-DOLQZWNJSA-N |
| SMILES | CCCCO[C@]1([C@H]([C@@H]([C@H](O1)CO)O)O)CO |
Computed by PubChem (NCBI)