CAS 22342-46-7 appears in our catalog under these names: Biotin EP Impurity C, Diamino Biotin, >95% (HPLC), Diamino biotin, Diaminobiotin, Diaminobiotin, 98%. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 50mg, 5mg, 2mg, 10mg, 25mg.
5-[(2S,3S,4R)-3,4-diaminothiolan-2-yl]pentanoic acid (CAS 22342-46-7) is a chemical compound with the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. IUPAC name: 5-[(2S,3S,4R)-3,4-diaminothiolan-2-yl]pentanoic acid. InChIKey: JKNCSZDPWAVQAI-ZKWXMUAHSA-N.
| Molecular formula | C9H18N2O2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 5-[(2S,3S,4R)-3,4-diaminothiolan-2-yl]pentanoic acid |
| InChIKey | JKNCSZDPWAVQAI-ZKWXMUAHSA-N |
| SMILES | C1[C@@H]([C@@H]([C@@H](S1)CCCCC(=O)O)N)N |
Computed by PubChem (NCBI)