CAS 223487-53-4 is the registry number for 1-Bromobutane-2,2,3,3,4,4,4-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
4-bromo-1,1,1,2,2,3,3-heptadeuteriobutane (CAS 223487-53-4) is a chemical compound with the molecular formula C4H9Br and a molecular weight of 144.06 g/mol. IUPAC name: 4-bromo-1,1,1,2,2,3,3-heptadeuteriobutane. InChIKey: MPPPKRYCTPRNTB-NCKGIQLSSA-N.
| Molecular formula | C4H9Br |
|---|---|
| Molecular weight | 144.06 g/mol |
| IUPAC name | 4-bromo-1,1,1,2,2,3,3-heptadeuteriobutane |
| InChIKey | MPPPKRYCTPRNTB-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])CBr |
Computed by PubChem (NCBI)