Products 223487-53-4

CAS 223487-53-4 is the registry number for 1-Bromobutane-2,2,3,3,4,4,4-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

4-bromo-1,1,1,2,2,3,3-heptadeuteriobutane (CAS 223487-53-4) is a chemical compound with the molecular formula C4H9Br and a molecular weight of 144.06 g/mol. IUPAC name: 4-bromo-1,1,1,2,2,3,3-heptadeuteriobutane. InChIKey: MPPPKRYCTPRNTB-NCKGIQLSSA-N.

Identity
Molecular formulaC4H9Br
Molecular weight144.06 g/mol
IUPAC name4-bromo-1,1,1,2,2,3,3-heptadeuteriobutane
InChIKeyMPPPKRYCTPRNTB-NCKGIQLSSA-N
SMILES[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])CBr

Computed by PubChem (NCBI)