CAS 304700-80-9 is the registry number for 2-Bromobutane-d5. Offered by: TRC. Available pack sizes: 500mg.
3-bromo-1,1,1,2,2-pentadeuteriobutane (CAS 304700-80-9) is a chemical compound with the molecular formula C4H9Br and a molecular weight of 142.05 g/mol. IUPAC name: 3-bromo-1,1,1,2,2-pentadeuteriobutane. InChIKey: UPSXAPQYNGXVBF-WNWXXORZSA-N.
| Molecular formula | C4H9Br |
|---|---|
| Molecular weight | 142.05 g/mol |
| IUPAC name | 3-bromo-1,1,1,2,2-pentadeuteriobutane |
| InChIKey | UPSXAPQYNGXVBF-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(C)Br |
Computed by PubChem (NCBI)