CAS 344299-41-8 appears in our catalog under these names: 1-Bromo-2-methylpropane-d7, >95% (GC), 1-Bromo-2-methyl-d3-propane-2,3,3,3-d4, 98 atom % D, min 97% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 1g, 250mg, 0,5g.
2-(bromomethyl)-1,1,1,2,3,3,3-heptadeuteriopropane (CAS 344299-41-8) is a chemical compound with the molecular formula C4H9Br and a molecular weight of 144.06 g/mol. IUPAC name: 2-(bromomethyl)-1,1,1,2,3,3,3-heptadeuteriopropane. InChIKey: HLVFKOKELQSXIQ-UAVYNJCWSA-N.
| Molecular formula | C4H9Br |
|---|---|
| Molecular weight | 144.06 g/mol |
| IUPAC name | 2-(bromomethyl)-1,1,1,2,3,3,3-heptadeuteriopropane |
| InChIKey | HLVFKOKELQSXIQ-UAVYNJCWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CBr)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)