CAS 202392-72-1 appears in our catalog under these names: 2-Bromobutane-d9, (±)-2-Bromobutane-d9, 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,25g, 0,1g, 100mg, 500mg.
2-bromo-1,1,1,2,3,3,4,4,4-nonadeuteriobutane (CAS 202392-72-1) is a chemical compound with the molecular formula C4H9Br and a molecular weight of 146.07 g/mol. IUPAC name: 2-bromo-1,1,1,2,3,3,4,4,4-nonadeuteriobutane. InChIKey: UPSXAPQYNGXVBF-CBZKUFJVSA-N.
| Molecular formula | C4H9Br |
|---|---|
| Molecular weight | 146.07 g/mol |
| IUPAC name | 2-bromo-1,1,1,2,3,3,4,4,4-nonadeuteriobutane |
| InChIKey | UPSXAPQYNGXVBF-CBZKUFJVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)