CAS 223575-89-1 is the registry number for 2'-Formyl-(1,1'-biphenyl)-3-carbonitrile, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-(2-formylphenyl)benzonitrile (CAS 223575-89-1) is a chemical compound with the molecular formula C14H9NO and a molecular weight of 207.23 g/mol. IUPAC name: 3-(2-formylphenyl)benzonitrile. InChIKey: XBVNESQLFDHZRH-UHFFFAOYSA-N.
| Molecular formula | C14H9NO |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 3-(2-formylphenyl)benzonitrile |
| InChIKey | XBVNESQLFDHZRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)