Products 6136-62-5

CAS 6136-62-5 is the registry number for 3-Benzoylbenzonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

3-benzoylbenzonitrile (CAS 6136-62-5) is a chemical compound with the molecular formula C14H9NO and a molecular weight of 207.23 g/mol. IUPAC name: 3-benzoylbenzonitrile. InChIKey: ICRUXLLOLAPKFS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9NO
Molecular weight207.23 g/mol
IUPAC name3-benzoylbenzonitrile
InChIKeyICRUXLLOLAPKFS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)C#N

Computed by PubChem (NCBI)