Products 400744-71-0
CAS 400744-71-0 is the registry number for 3'-Formyl-(1,1'-biphenyl)-2-carbonitrile, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3-formylphenyl)benzonitrile (CAS 400744-71-0) is a chemical compound with the molecular formula C14H9NO and a molecular weight of 207.23 g/mol. IUPAC name: 2-(3-formylphenyl)benzonitrile. InChIKey: KVPZVMLTYRMJNO-UHFFFAOYSA-N.
| Molecular formula | C14H9NO |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-(3-formylphenyl)benzonitrile |
| InChIKey | KVPZVMLTYRMJNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)