CAS 50670-55-8 is the registry number for 4'-Formyl-(1,1'-biphenyl)-4-carbonitrile, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-(4-formylphenyl)benzonitrile (CAS 50670-55-8) is a chemical compound with the molecular formula C14H9NO and a molecular weight of 207.23 g/mol. IUPAC name: 4-(4-formylphenyl)benzonitrile. InChIKey: RCQRVCXPHMXSRD-UHFFFAOYSA-N.
| Molecular formula | C14H9NO |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 4-(4-formylphenyl)benzonitrile |
| InChIKey | RCQRVCXPHMXSRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)