CAS 223671-16-7 is the registry number for 6-Bromoisoquinoline 2-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromo-2-oxidoisoquinolin-2-ium (CAS 223671-16-7) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 6-bromo-2-oxidoisoquinolin-2-ium. InChIKey: QNNTUJSIGVWFAS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 6-bromo-2-oxidoisoquinolin-2-ium |
| InChIKey | QNNTUJSIGVWFAS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C[N+](=C2)[O-])C=C1Br |
Computed by PubChem (NCBI)