CAS 223671-18-9 appears in our catalog under these names: 7-Bromoisoquinoline n-oxide, 95%, 7-Bromoisoquinoline 2-oxide, 95%, 95%, 7-BROMOISOQUINOLIN-2-IUM-2-OLATE, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
7-bromo-2-oxidoisoquinolin-2-ium (CAS 223671-18-9) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 7-bromo-2-oxidoisoquinolin-2-ium. InChIKey: QLRDQGRZLHHBPE-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 7-bromo-2-oxidoisoquinolin-2-ium |
| InChIKey | QLRDQGRZLHHBPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=C[N+](=C2)[O-])Br |
Computed by PubChem (NCBI)