CAS 223932-34-1 is the registry number for Rel-(1R,4R)-4-{((2-nitrophenyl)methyl)amino}cyclohexan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[(2-nitrophenyl)methylamino]cyclohexan-1-ol (CAS 223932-34-1) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: 4-[(2-nitrophenyl)methylamino]cyclohexan-1-ol. InChIKey: DELTZHFOMFJNKL-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 4-[(2-nitrophenyl)methylamino]cyclohexan-1-ol |
| InChIKey | DELTZHFOMFJNKL-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NCC2=CC=CC=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)