Products 2973403-73-3
CAS 2973403-73-3 is the registry number for (1S,2R)-N1,N1-Dimethylcyclohexane-1,2-diamine dihydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Cis-(1R,2S)-2-N,2-N-dimethylcyclohexane-1,2-diamine;dihydrochloride (CAS 2973403-73-3) is a chemical compound with the molecular formula C8H20Cl2N2 and a molecular weight of 215.16 g/mol. IUPAC name: cis-(1R,2S)-2-N,2-N-dimethylcyclohexane-1,2-diamine;dihydrochloride. InChIKey: BZJVMZDYSWJIIG-YUZCMTBUSA-N.
| Molecular formula | C8H20Cl2N2 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | cis-(1R,2S)-2-N,2-N-dimethylcyclohexane-1,2-diamine;dihydrochloride |
| InChIKey | BZJVMZDYSWJIIG-YUZCMTBUSA-N |
| SMILES | CN(C)[C@H]1CCCC[C@H]1N.Cl.Cl |
Computed by PubChem (NCBI)