CAS 2240179-62-6 appears in our catalog under these names: Dexmedetomidine Impurity 1, Medetomidine Impurity 27, 5-(1-(3,4-Dimethylphenyl)ethyl)-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[1-(3,4-dimethylphenyl)ethyl]-1H-imidazole (CAS 2240179-62-6) is a chemical compound with the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. IUPAC name: 5-[1-(3,4-dimethylphenyl)ethyl]-1H-imidazole. InChIKey: ZSTJCNFENYWUEV-UHFFFAOYSA-N.
| Molecular formula | C13H16N2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 5-[1-(3,4-dimethylphenyl)ethyl]-1H-imidazole |
| InChIKey | ZSTJCNFENYWUEV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)C2=CN=CN2)C |
Computed by PubChem (NCBI)