Products 2240185-66-2
CAS 2240185-66-2 is the registry number for 1,3-Dioxoisoindolin-2-yl 1-((tert-butoxycarbonyl)amino)cyclopropane-1-carboxylate, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g.
(1,3-dioxoisoindol-2-yl) 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate (CAS 2240185-66-2) is a chemical compound with the molecular formula C17H18N2O6 and a molecular weight of 346.3 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate. InChIKey: KAISCOMLUPFPPE-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O6 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
| InChIKey | KAISCOMLUPFPPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC1)C(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)