Products 224036-12-8
CAS 224036-12-8 is the registry number for 2,3-Dihydro-1-(4-nitrophenyl)-1H-indole, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(4-nitrophenyl)-2,3-dihydroindole (CAS 224036-12-8) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 1-(4-nitrophenyl)-2,3-dihydroindole. InChIKey: MGFAOBIKDRICQH-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-2,3-dihydroindole |
| InChIKey | MGFAOBIKDRICQH-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)