Products 22404-78-0
CAS 22404-78-0 appears in our catalog under these names: Dimethyl 9H-carbazole-3,6-dicarboxylate, 97%, 97%, Dimethyl 9H-carbazole-3,6-dicarboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Dimethyl 9H-carbazole-3,6-dicarboxylate (CAS 22404-78-0) is a chemical compound with the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. IUPAC name: dimethyl 9H-carbazole-3,6-dicarboxylate. InChIKey: MSIMLJKNXDMHNO-UHFFFAOYSA-N.
| Molecular formula | C16H13NO4 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | dimethyl 9H-carbazole-3,6-dicarboxylate |
| InChIKey | MSIMLJKNXDMHNO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NC3=C2C=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)