Products 2241138-10-1
CAS 2241138-10-1 is the registry number for tert-Butyl N-((5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)methyl)carbamate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-[(5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]carbamate;hydrochloride (CAS 2241138-10-1) is a chemical compound with the molecular formula C16H25ClN2O2 and a molecular weight of 312.83 g/mol. IUPAC name: tert-butyl N-[(5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]carbamate;hydrochloride. InChIKey: ARIYUJTUVCKNGV-UHFFFAOYSA-N.
| Molecular formula | C16H25ClN2O2 |
|---|---|
| Molecular weight | 312.83 g/mol |
| IUPAC name | tert-butyl N-[(5-amino-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]carbamate;hydrochloride |
| InChIKey | ARIYUJTUVCKNGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC2=C(C=C1)C(CCC2)N.Cl |
Computed by PubChem (NCBI)