Products 154206-10-7
CAS 154206-10-7 appears in our catalog under these names: Rac-tert-butyl N-{((3R,4S)-4-phenylpyrrolidin-3-yl)methyl}carbamate, 95%, rac-tert-Butyl N-{((3R,4S)-4-phenylpyrrolidin-3-yl)methyl}carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-[[(3S,4R)-4-phenylpyrrolidin-3-yl]methyl]carbamate;hydrochloride (CAS 154206-10-7) is a chemical compound with the molecular formula C16H25ClN2O2 and a molecular weight of 312.83 g/mol. IUPAC name: tert-butyl N-[[(3S,4R)-4-phenylpyrrolidin-3-yl]methyl]carbamate;hydrochloride. InChIKey: JYOSIOWMNGYKFF-IODNYQNNSA-N.
| Molecular formula | C16H25ClN2O2 |
|---|---|
| Molecular weight | 312.83 g/mol |
| IUPAC name | tert-butyl N-[[(3S,4R)-4-phenylpyrrolidin-3-yl]methyl]carbamate;hydrochloride |
| InChIKey | JYOSIOWMNGYKFF-IODNYQNNSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CNC[C@H]1C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)