Products 1823856-99-0

CAS 1823856-99-0 is the registry number for Benzyl ((3-methylazepan-4-yl)methyl)carbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(3-methylazepan-4-yl)methyl]carbamate;hydrochloride (CAS 1823856-99-0) is a chemical compound with the molecular formula C16H25ClN2O2 and a molecular weight of 312.83 g/mol. IUPAC name: benzyl N-[(3-methylazepan-4-yl)methyl]carbamate;hydrochloride. InChIKey: QMUPKNSVXYXJDX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25ClN2O2
Molecular weight312.83 g/mol
IUPAC namebenzyl N-[(3-methylazepan-4-yl)methyl]carbamate;hydrochloride
InChIKeyQMUPKNSVXYXJDX-UHFFFAOYSA-N
SMILESCC1CNCCCC1CNC(=O)OCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)