CAS 2726492-53-9 is the registry number for Ropinirole N-Oxide Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
N-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl]-N-propylpropan-1-amine oxide;hydrochloride (CAS 2726492-53-9) is a chemical compound with the molecular formula C16H25ClN2O2 and a molecular weight of 312.83 g/mol. IUPAC name: N-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl]-N-propylpropan-1-amine oxide;hydrochloride. InChIKey: IUEHDKXXYREZCO-UHFFFAOYSA-N.
| Molecular formula | C16H25ClN2O2 |
|---|---|
| Molecular weight | 312.83 g/mol |
| IUPAC name | N-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl]-N-propylpropan-1-amine oxide;hydrochloride |
| InChIKey | IUEHDKXXYREZCO-UHFFFAOYSA-N |
| SMILES | CCC[N+](CCC)(CCC1=C2CC(=O)NC2=CC=C1)[O-].Cl |
Computed by PubChem (NCBI)