Products 1333839-80-7

CAS 1333839-80-7 appears in our catalog under these names: Benzyl 2,5-diethylpiperazine-1-carboxylate hydrochloride, 97%, Benzyl 2,5-diethylpiperazine-1-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Benzyl 2,5-diethylpiperazine-1-carboxylate;hydrochloride (CAS 1333839-80-7) is a chemical compound with the molecular formula C16H25ClN2O2 and a molecular weight of 312.83 g/mol. IUPAC name: benzyl 2,5-diethylpiperazine-1-carboxylate;hydrochloride. InChIKey: KDWBFQOPCKXYCW-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25ClN2O2
Molecular weight312.83 g/mol
IUPAC namebenzyl 2,5-diethylpiperazine-1-carboxylate;hydrochloride
InChIKeyKDWBFQOPCKXYCW-UHFFFAOYSA-N
SMILESCCC1CNC(CN1C(=O)OCC2=CC=CC=C2)CC.Cl

Computed by PubChem (NCBI)