Products 2241139-04-6
CAS 2241139-04-6 is the registry number for 1,4,4-Trimethylpyrrolidine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,4,4-trimethylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 2241139-04-6) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: 1,4,4-trimethylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: RUYZGEQMZPCWIE-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 1,4,4-trimethylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | RUYZGEQMZPCWIE-UHFFFAOYSA-N |
| SMILES | CC1(CC(N(C1)C)C(=O)O)C.Cl |
Computed by PubChem (NCBI)