Products 2241140-01-0
CAS 2241140-01-0 is the registry number for 2-(Methoxycarbonyl)-4H-thieno(3,2-b)pyrrole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methoxycarbonyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CAS 2241140-01-0) is a chemical compound with the molecular formula C9H7NO4S and a molecular weight of 225.22 g/mol. IUPAC name: 2-methoxycarbonyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: VCUIXNOGJCKNMW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4S |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | 2-methoxycarbonyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | VCUIXNOGJCKNMW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)