Products 2241141-99-9
CAS 2241141-99-9 is the registry number for rac-(3aR,6aR)-5-Ethyl-hexahydro-1H-furo(3,4-c)pyrrole-3a-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aR,6aR)-5-ethyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid;hydrochloride (CAS 2241141-99-9) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: (3aR,6aR)-5-ethyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid;hydrochloride. InChIKey: DKXBYKADUUCLOU-PRCZDLBKSA-N.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | (3aR,6aR)-5-ethyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid;hydrochloride |
| InChIKey | DKXBYKADUUCLOU-PRCZDLBKSA-N |
| SMILES | CCN1C[C@@H]2COC[C@@]2(C1)C(=O)O.Cl |
Computed by PubChem (NCBI)