CAS 2241142-05-0 is the registry number for 3',4'-Dihydrospiro(cyclohexane-1,2'-pyrano(2,3-b)pyridine)-4'-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Spiro[3H-pyrano[2,3-b]pyridine-2,1'-cyclohexane]-4-one (CAS 2241142-05-0) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: spiro[3H-pyrano[2,3-b]pyridine-2,1'-cyclohexane]-4-one. InChIKey: ZUNXZPHFHFSONM-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | spiro[3H-pyrano[2,3-b]pyridine-2,1'-cyclohexane]-4-one |
| InChIKey | ZUNXZPHFHFSONM-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)C3=C(O2)N=CC=C3 |
Computed by PubChem (NCBI)