CAS 2241594-08-9 is the registry number for METHYL 1-AMINO-2,3-DIHYDRO-1H-INDENE-5-CARBOXYLATE HCL, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride (CAS 2241594-08-9) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride. InChIKey: UOZGMHAMWDHRQO-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride |
| InChIKey | UOZGMHAMWDHRQO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(CC2)N.Cl |
Computed by PubChem (NCBI)