Products 2241720-33-0
CAS 2241720-33-0 is the registry number for 2-Amino-4-bromo-3-fluoro-5-iodobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-4-bromo-3-fluoro-5-iodobenzoic acid (CAS 2241720-33-0) is a chemical compound with the molecular formula C7H4BrFINO2 and a molecular weight of 359.92 g/mol. IUPAC name: 2-amino-4-bromo-3-fluoro-5-iodobenzoic acid. InChIKey: RFWMDOCRIQPLRW-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFINO2 |
|---|---|
| Molecular weight | 359.92 g/mol |
| IUPAC name | 2-amino-4-bromo-3-fluoro-5-iodobenzoic acid |
| InChIKey | RFWMDOCRIQPLRW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1I)Br)F)N)C(=O)O |
Computed by PubChem (NCBI)