Products 2773311-18-3
CAS 2773311-18-3 is the registry number for 2-Amino-4-bromo-5-fluoro-3-iodobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-4-bromo-5-fluoro-3-iodobenzoic acid (CAS 2773311-18-3) is a chemical compound with the molecular formula C7H4BrFINO2 and a molecular weight of 359.92 g/mol. IUPAC name: 2-amino-4-bromo-5-fluoro-3-iodobenzoic acid. InChIKey: BVJGHFGMBKZPCT-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFINO2 |
|---|---|
| Molecular weight | 359.92 g/mol |
| IUPAC name | 2-amino-4-bromo-5-fluoro-3-iodobenzoic acid |
| InChIKey | BVJGHFGMBKZPCT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)I)N)C(=O)O |
Computed by PubChem (NCBI)