Products 2845126-35-2
CAS 2845126-35-2 is the registry number for 3-Bromo-2-fluoro-1-iodo-4-methyl-5-nitrobenzene, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-2-fluoro-1-iodo-4-methyl-5-nitrobenzene (CAS 2845126-35-2) is a chemical compound with the molecular formula C7H4BrFINO2 and a molecular weight of 359.92 g/mol. IUPAC name: 3-bromo-2-fluoro-1-iodo-4-methyl-5-nitrobenzene. InChIKey: ULFMCCRWIFPMSN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFINO2 |
|---|---|
| Molecular weight | 359.92 g/mol |
| IUPAC name | 3-bromo-2-fluoro-1-iodo-4-methyl-5-nitrobenzene |
| InChIKey | ULFMCCRWIFPMSN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1[N+](=O)[O-])I)F)Br |
Computed by PubChem (NCBI)