Products 2833669-83-1

CAS 2833669-83-1 is the registry number for 2-Amino-5-bromo-4-fluoro-3-iodobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-5-bromo-4-fluoro-3-iodobenzoic acid (CAS 2833669-83-1) is a chemical compound with the molecular formula C7H4BrFINO2 and a molecular weight of 359.92 g/mol. IUPAC name: 2-amino-5-bromo-4-fluoro-3-iodobenzoic acid. InChIKey: GMHPAMPUYZTFPO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrFINO2
Molecular weight359.92 g/mol
IUPAC name2-amino-5-bromo-4-fluoro-3-iodobenzoic acid
InChIKeyGMHPAMPUYZTFPO-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1Br)F)I)N)C(=O)O

Computed by PubChem (NCBI)