CAS 2091653-09-5 is the registry number for 2-(Bromomethyl)-4-fluoro-3-iodo-1-nitrobenzene. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(bromomethyl)-1-fluoro-2-iodo-4-nitrobenzene (CAS 2091653-09-5) is a chemical compound with the molecular formula C7H4BrFINO2 and a molecular weight of 359.92 g/mol. IUPAC name: 3-(bromomethyl)-1-fluoro-2-iodo-4-nitrobenzene. InChIKey: UDSOMSJVXYYFEB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFINO2 |
|---|---|
| Molecular weight | 359.92 g/mol |
| IUPAC name | 3-(bromomethyl)-1-fluoro-2-iodo-4-nitrobenzene |
| InChIKey | UDSOMSJVXYYFEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])CBr)I)F |
Computed by PubChem (NCBI)