CAS 224173-50-6 is the registry number for 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-3-(1H-pyrazol-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrazol-1-ylpropanoic acid (CAS 224173-50-6) is a chemical compound with the molecular formula C21H19N3O4 and a molecular weight of 377.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrazol-1-ylpropanoic acid. InChIKey: LFIMKADLAIDVGC-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrazol-1-ylpropanoic acid |
| InChIKey | LFIMKADLAIDVGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CN4C=CC=N4)C(=O)O |
Computed by PubChem (NCBI)