Products 948594-98-7
CAS 948594-98-7 is the registry number for (αR)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1H-pyrazole-1-propanoic acid, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrazol-1-ylpropanoic acid (CAS 948594-98-7) is a chemical compound with the molecular formula C21H19N3O4 and a molecular weight of 377.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrazol-1-ylpropanoic acid. InChIKey: LFIMKADLAIDVGC-LJQANCHMSA-N.
| Molecular formula | C21H19N3O4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrazol-1-ylpropanoic acid |
| InChIKey | LFIMKADLAIDVGC-LJQANCHMSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CN4C=CC=N4)C(=O)O |
Computed by PubChem (NCBI)